Difference between revisions of "S-ubiquitinyl-HECT-E3-UCP-L-cysteine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHENYL-PYRUVATE == * common-name: ** keto-phenylpyruvate * smiles: ** c([o-])(=o)c(=o)cc1(=cc=cc=c1) * inchi-key: ** btnmpgbkdvtsjy-uhfff...")
(Created page with "Category:metabolite == Metabolite CPD-15661 == * common-name: ** 2-trans, 4-trans-undecadienoyl-coa * smiles: ** ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHENYL-PYRUVATE ==
+
== Metabolite CPD-15661 ==
 
* common-name:
 
* common-name:
** keto-phenylpyruvate
+
** 2-trans, 4-trans-undecadienoyl-coa
 
* smiles:
 
* smiles:
** c([o-])(=o)c(=o)cc1(=cc=cc=c1)
+
** ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** btnmpgbkdvtsjy-uhfffaoysa-m
+
** szkpluulggerfd-msnzeopqsa-j
 
* molecular-weight:
 
* molecular-weight:
** 163.152
+
** 927.749
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.6.1.64-RXN]]
+
* [[RXN-14790]]
* [[PHEAMINOTRANS-RXN]]
+
* [[RXN-14791]]
* [[PREPHENATEDEHYDRAT-RXN]]
 
* [[RXN-10814]]
 
* [[RXN-10815]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.6.1.64-RXN]]
+
* [[RXN-14789]]
* [[PHEAMINOTRANS-RXN]]
 
* [[PPDH]]
 
* [[PREPHENATEDEHYDRAT-RXN]]
 
* [[RXN-10814]]
 
* [[RXN-17130]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=keto-phenylpyruvate}}
+
{{#set: common-name=2-trans, 4-trans-undecadienoyl-coa}}
{{#set: inchi-key=inchikey=btnmpgbkdvtsjy-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=szkpluulggerfd-msnzeopqsa-j}}
{{#set: molecular-weight=163.152}}
+
{{#set: molecular-weight=927.749}}

Revision as of 08:31, 15 March 2021

Metabolite CPD-15661

  • common-name:
    • 2-trans, 4-trans-undecadienoyl-coa
  • smiles:
    • ccccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • szkpluulggerfd-msnzeopqsa-j
  • molecular-weight:
    • 927.749

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality