Difference between revisions of "CPD-11400"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6993 == * common-name: ** pinocembrin chalcone * smiles: ** c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2) * inchi-key: ** loyxtwzxlwh...")
(Created page with "Category:metabolite == Metabolite CPD-15382 == * common-name: ** keto-d-fructose * smiles: ** c(o)c(=o)c(o)c(o)c(o)co * inchi-key: ** bjhikxhvcxfqls-uyfozjqfsa-n * molecul...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-6993 ==
+
== Metabolite CPD-15382 ==
 
* common-name:
 
* common-name:
** pinocembrin chalcone
+
** keto-d-fructose
 
* smiles:
 
* smiles:
** c2(c=cc(c=cc(c1(=c(c=c(c=c(o)1)o)o))=o)=cc=2)
+
** c(o)c(=o)c(o)c(o)c(o)co
 
* inchi-key:
 
* inchi-key:
** loyxtwzxlwhmbx-votsokgwsa-n
+
** bjhikxhvcxfqls-uyfozjqfsa-n
 
* molecular-weight:
 
* molecular-weight:
** 256.257
+
** 180.157
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7647]]
+
* [[GLUCISOM-RXN]]
 +
* [[GLUCISOM-RXN-ALPHA-GLUCOSE//CPD-15382.25.]]
 +
* [[GLUCISOM-RXN-GLC//CPD-15382.15.]]
 +
* [[MANNITOL-2-DEHYDROGENASE-RXN]]
 +
* [[RXN-7644]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7645]]
+
* [[GLUCISOM-RXN]]
 +
* [[GLUCISOM-RXN-ALPHA-GLUCOSE//CPD-15382.25.]]
 +
* [[GLUCISOM-RXN-GLC//CPD-15382.15.]]
 +
* [[MANNITOL-2-DEHYDROGENASE-RXN]]
 +
* [[RXN-7644]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pinocembrin chalcone}}
+
{{#set: common-name=keto-d-fructose}}
{{#set: inchi-key=inchikey=loyxtwzxlwhmbx-votsokgwsa-n}}
+
{{#set: inchi-key=inchikey=bjhikxhvcxfqls-uyfozjqfsa-n}}
{{#set: molecular-weight=256.257}}
+
{{#set: molecular-weight=180.157}}

Revision as of 08:31, 15 March 2021

Metabolite CPD-15382

  • common-name:
    • keto-d-fructose
  • smiles:
    • c(o)c(=o)c(o)c(o)c(o)co
  • inchi-key:
    • bjhikxhvcxfqls-uyfozjqfsa-n
  • molecular-weight:
    • 180.157

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality