Difference between revisions of "3-Polyrenyl-benzene-1-2-diols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHYTYL-PYROPHOSPHATE == * common-name: ** phytyl diphosphate * smiles: ** cc(cccc(cccc(cccc(=ccop([o-])(=o)op([o-])(=o)[o-])c)c)c)c * inc...") |
(Created page with "Category:metabolite == Metabolite CPD-17637 == * common-name: ** 7-hydroxylaurate * smiles: ** cccccc(o)cccccc([o-])=o * inchi-key: ** bnwkmhuffkdamv-uhfffaoysa-m * molecu...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-17637 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 7-hydroxylaurate |
* smiles: | * smiles: | ||
| − | ** | + | ** cccccc(o)cccccc([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** bnwkmhuffkdamv-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 215.312 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12184]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=7-hydroxylaurate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bnwkmhuffkdamv-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=215.312}} |
Revision as of 08:31, 15 March 2021
Contents
Metabolite CPD-17637
- common-name:
- 7-hydroxylaurate
- smiles:
- cccccc(o)cccccc([o-])=o
- inchi-key:
- bnwkmhuffkdamv-uhfffaoysa-m
- molecular-weight:
- 215.312
