Difference between revisions of "CPD-3041"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite tRNA-Containing-N1-Methylguanine-37 == * common-name: ** an n1-methylguanine37 in trna == Reaction(s) known to consume the compound == ==...")
(Created page with "Category:metabolite == Metabolite CPD-14422 == * common-name: ** 3-oxo-icosatrienoyl-coa * smiles: ** ccc=ccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite tRNA-Containing-N1-Methylguanine-37 ==
+
== Metabolite CPD-14422 ==
 
* common-name:
 
* common-name:
** an n1-methylguanine37 in trna
+
** 3-oxo-icosatrienoyl-coa
 +
* smiles:
 +
** ccc=ccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi-key:
 +
** dfyfqqxxtclfng-ubqhhbpxsa-j
 +
* molecular-weight:
 +
** 1065.958
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-12994]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12458]]
+
* [[RXN-13441]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an n1-methylguanine37 in trna}}
+
{{#set: common-name=3-oxo-icosatrienoyl-coa}}
 +
{{#set: inchi-key=inchikey=dfyfqqxxtclfng-ubqhhbpxsa-j}}
 +
{{#set: molecular-weight=1065.958}}

Revision as of 08:31, 15 March 2021

Metabolite CPD-14422

  • common-name:
    • 3-oxo-icosatrienoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • dfyfqqxxtclfng-ubqhhbpxsa-j
  • molecular-weight:
    • 1065.958

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality