Difference between revisions of "CPD-15362"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Palmitoyl-ACPs == * common-name: ** a palmitoyl-[acp] == Reaction(s) known to consume the compound == * RXN-16025 * RXN-17018 * [...") |
(Created page with "Category:metabolite == Metabolite CPD-10809 == * common-name: ** 2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one * smiles: ** c(nc1(n=c(nc(=o)c(n)=1)n))c(o)c(o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-10809 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one |
| + | * smiles: | ||
| + | ** c(nc1(n=c(nc(=o)c(n)=1)n))c(o)c(o)c(o)cop([o-])(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** acivvgbvovhfpq-rpdrrwsusa-l | ||
| + | * molecular-weight: | ||
| + | ** 353.228 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14171]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-10057]] |
| − | * [[RXN- | + | * [[RXN-14171]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one}} |
| + | {{#set: inchi-key=inchikey=acivvgbvovhfpq-rpdrrwsusa-l}} | ||
| + | {{#set: molecular-weight=353.228}} | ||
Revision as of 08:31, 15 March 2021
Contents
Metabolite CPD-10809
- common-name:
- 2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one
- smiles:
- c(nc1(n=c(nc(=o)c(n)=1)n))c(o)c(o)c(o)cop([o-])(=o)[o-]
- inchi-key:
- acivvgbvovhfpq-rpdrrwsusa-l
- molecular-weight:
- 353.228
