Difference between revisions of "3R-7Z-3-hydroxy-hexadec-7-enoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10809 == * common-name: ** 2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one * smiles: ** c(nc1(n=c(nc(=o)c(n)=1)n))c(o)c(o...")
(Created page with "Category:metabolite == Metabolite AMINO-ACETONE == * common-name: ** aminoacetone * smiles: ** cc(c[n+])=o * inchi-key: ** bcdgqxumwhrqcb-uhfffaoysa-o * molecular-weight:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-10809 ==
+
== Metabolite AMINO-ACETONE ==
 
* common-name:
 
* common-name:
** 2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one
+
** aminoacetone
 
* smiles:
 
* smiles:
** c(nc1(n=c(nc(=o)c(n)=1)n))c(o)c(o)c(o)cop([o-])(=o)[o-]
+
** cc(c[n+])=o
 
* inchi-key:
 
* inchi-key:
** acivvgbvovhfpq-rpdrrwsusa-l
+
** bcdgqxumwhrqcb-uhfffaoysa-o
 
* molecular-weight:
 
* molecular-weight:
** 353.228
+
** 74.102
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14171]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10057]]
+
* [[RXN-14249]]
* [[RXN-14171]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2,5-diamino-6-(5-phospho-d-ribitylamino)pyrimidin-4(3h)-one}}
+
{{#set: common-name=aminoacetone}}
{{#set: inchi-key=inchikey=acivvgbvovhfpq-rpdrrwsusa-l}}
+
{{#set: inchi-key=inchikey=bcdgqxumwhrqcb-uhfffaoysa-o}}
{{#set: molecular-weight=353.228}}
+
{{#set: molecular-weight=74.102}}

Revision as of 08:31, 15 March 2021

Metabolite AMINO-ACETONE

  • common-name:
    • aminoacetone
  • smiles:
    • cc(c[n+])=o
  • inchi-key:
    • bcdgqxumwhrqcb-uhfffaoysa-o
  • molecular-weight:
    • 74.102

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality