Difference between revisions of "CPD-12677"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17328 == * common-name: ** (9z,12z,15z,18z)-tetracosatetraenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=ccccccccc(sccnc(=o)ccnc(=o)c(o)c(...")
(Created page with "Category:metabolite == Metabolite Carotenoid-beta-end-group == * common-name: ** a carotenoid β-end group == Reaction(s) known to consume the compound == == Reaction(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17328 ==
+
== Metabolite Carotenoid-beta-end-group ==
 
* common-name:
 
* common-name:
** (9z,12z,15z,18z)-tetracosatetraenoyl-coa
+
** a carotenoid β-end group
* smiles:
 
** cccccc=ccc=ccc=ccc=ccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
* inchi-key:
 
** okoxeytyhdptew-gjykhrjnsa-j
 
* molecular-weight:
 
** 1106.066
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17112]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12496]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(9z,12z,15z,18z)-tetracosatetraenoyl-coa}}
+
{{#set: common-name=a carotenoid β-end group}}
{{#set: inchi-key=inchikey=okoxeytyhdptew-gjykhrjnsa-j}}
 
{{#set: molecular-weight=1106.066}}
 

Revision as of 08:31, 15 March 2021

Metabolite Carotenoid-beta-end-group

  • common-name:
    • a carotenoid β-end group

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality