Difference between revisions of "CPD-17275"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Delta-14-steroids == * common-name: ** a δ14steroid == Reaction(s) known to consume the compound == == Reaction(s) known to produce...")
(Created page with "Category:metabolite == Metabolite DGDP == * common-name: ** dgdp * smiles: ** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** cikg...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Delta-14-steroids ==
+
== Metabolite DGDP ==
 
* common-name:
 
* common-name:
** a δ14steroid
+
** dgdp
 +
* smiles:
 +
** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
 +
* inchi-key:
 +
** cikgwctvfsrmju-kvqbguixsa-k
 +
* molecular-weight:
 +
** 424.18
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ATDGD]]
 +
* [[DGDPKIN-RXN]]
 +
* [[DGTPtm]]
 +
* [[RXN-14207]]
 +
* [[RXN-14218]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13961]]
+
* [[ATDGM]]
 +
* [[DGOTO]]
 +
* [[DGTCY]]
 +
* [[DGTPtm]]
 +
* [[DGTUP]]
 +
* [[GDPREDUCT-RXN]]
 +
* [[RXN-14217]]
 +
* [[RXN0-748]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a δ14steroid}}
+
{{#set: common-name=dgdp}}
 +
{{#set: inchi-key=inchikey=cikgwctvfsrmju-kvqbguixsa-k}}
 +
{{#set: molecular-weight=424.18}}

Revision as of 08:32, 15 March 2021

Metabolite DGDP

  • common-name:
    • dgdp
  • smiles:
    • c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
  • inchi-key:
    • cikgwctvfsrmju-kvqbguixsa-k
  • molecular-weight:
    • 424.18

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality