Difference between revisions of "PWY-7112"

Revision as of 14:19, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13187 CPD-13187] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHATIDYLINOSITOL-345-TRIPHOSPHATE PHOSPHATIDYLINOSITOL-345-TRIPHOSPHATE] ==
 * common-name:
-** unsaturated gellan tetrasaccharide
+** 1-phosphatidyl-1d-myo-inositol 3,4,5-trisphosphate
-* smiles:
-** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)oc4(oc(c([o-])=o)=cc(o)c(o)4)))
-* inchi-key:
-** jmdplhpaglyhci-pqvubfrasa-m
-* molecular-weight:
-** 645.544
 == Reaction(s) known to consume the compound ==
-* [[RXN-12270]]
+* [[3.1.3.67-RXN]]
+* [[RXN-10036]]
 == Reaction(s) known to produce the compound ==
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=unsaturated gellan tetrasaccharide}}
+{{#set: common-name=1-phosphatidyl-1d-myo-inositol 3,4,5-trisphosphate}}
-{{#set: inchi-key=inchikey=jmdplhpaglyhci-pqvubfrasa-m}}
-{{#set: molecular-weight=645.544}}