Difference between revisions of "CPD-11552"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Mannosyl5-N-Glycans == * common-name: ** man5glcnac2-[protein] (isomer 5a1,2) == Reaction(s) known to consume the compound == * 2.4.1.1...") |
(Created page with "Category:metabolite == Metabolite CPD-11552 == * common-name: ** 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate * smiles: ** c(=o)([o-])c(=o)cc(=o)c1(c=cc=c(o)c(n)=1) * in...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11552 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate |
| + | * smiles: | ||
| + | ** c(=o)([o-])c(=o)cc(=o)c1(c=cc=c(o)c(n)=1) | ||
| + | * inchi-key: | ||
| + | ** ycjnyhccoxvyaf-uhfffaoysa-m | ||
| + | * molecular-weight: | ||
| + | ** 222.177 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10721]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-10721]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate}} |
| + | {{#set: inchi-key=inchikey=ycjnyhccoxvyaf-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=222.177}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-11552
- common-name:
- 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate
- smiles:
- c(=o)([o-])c(=o)cc(=o)c1(c=cc=c(o)c(n)=1)
- inchi-key:
- ycjnyhccoxvyaf-uhfffaoysa-m
- molecular-weight:
- 222.177
