Difference between revisions of "N-Acylsphingosine"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ADENOSINE == * common-name: ** adenosine * smiles: ** c(o)c1(oc(c(o)c(o)1)n3(c=nc2(c(n)=nc=nc=23))) * inchi-key: ** oirdtqyftabqoq-kqynxx...") |
(Created page with "Category:metabolite == Metabolite N-Acylsphingosine == * common-name: ** a sphingosine ceramide == Reaction(s) known to consume the compound == * RXN-15211 == Reaction...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite N-Acylsphingosine == |
* common-name: | * common-name: | ||
− | ** | + | ** a sphingosine ceramide |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-15211]] |
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[GLUCOSYLCERAMIDASE-RXN]] |
− | * [[ | + | * [[RXN-15212]] |
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a sphingosine ceramide}} |
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite N-Acylsphingosine
- common-name:
- a sphingosine ceramide