Difference between revisions of "N-formyl-L-methionyl-tRNAfmet"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-INDOLYLGLYCOLALDEHYDE == * common-name: ** indole-3-glycol aldehyde * smiles: ** c2(=c(c1(c=cc=cc=1n2))c(o)c=o) * inchi-key: ** xkzdnwm...") |
(Created page with "Category:metabolite == Metabolite N-formyl-L-methionyl-tRNAfmet == * common-name: ** an n-formyl-l-methionyl-[initiator trnamet] == Reaction(s) known to consume the compou...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-formyl-L-methionyl-tRNAfmet == |
* common-name: | * common-name: | ||
| − | ** | + | ** an n-formyl-l-methionyl-[initiator trnamet] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[METHIONYL-TRNA-FORMYLTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an n-formyl-l-methionyl-[initiator trnamet]}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite N-formyl-L-methionyl-tRNAfmet
- common-name:
- an n-formyl-l-methionyl-[initiator trnamet]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an n-formyl-l-methionyl-[initiator trnamet" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
