Difference between revisions of "2-HYDROXY-2-METHYLPROPANENITRILE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13717 == * common-name: ** l-selenocystathionine * smiles: ** c([se]cc(c([o-])=o)[n+])cc([n+])c(=o)[o-] * inchi-key: ** znwydqpouqrdl...") |
(Created page with "Category:metabolite == Metabolite 2-HYDROXY-2-METHYLPROPANENITRILE == * common-name: ** 2-hydroxy-2-methylpropanenitrile * smiles: ** cc(o)(c)c#n * inchi-key: ** mwfmgbpga...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-HYDROXY-2-METHYLPROPANENITRILE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2-hydroxy-2-methylpropanenitrile |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(o)(c)c#n |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mwfmgbpgaxyfar-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 85.105 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-5341]] | |
| − | |||
| − | * [[RXN- | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2-hydroxy-2-methylpropanenitrile}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mwfmgbpgaxyfar-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=85.105}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite 2-HYDROXY-2-METHYLPROPANENITRILE
- common-name:
- 2-hydroxy-2-methylpropanenitrile
- smiles:
- cc(o)(c)c#n
- inchi-key:
- mwfmgbpgaxyfar-uhfffaoysa-n
- molecular-weight:
- 85.105
