Difference between revisions of "CPD-12829"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7247 == * common-name: ** all-trans-13,14-dihydroretinol * smiles: ** cc(=cc=cc(c)cco)c=cc1(=c(c)cccc(c)(c)1) * inchi-key: ** ovboqva...") |
(Created page with "Category:metabolite == Metabolite CPD-12829 == * common-name: ** plastoquinol-9 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(c)=cccc(=cccc(c)=cccc(c)=ccc1(=cc(=c(c(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-12829 == |
* common-name: | * common-name: | ||
| − | ** | + | ** plastoquinol-9 |
* smiles: | * smiles: | ||
| − | ** cc(= | + | ** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(c)=cccc(=cccc(c)=cccc(c)=ccc1(=cc(=c(c(=c1o)c)c)o))c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ijbljlrewplepb-iqsnhbbhsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 751.23 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-2762]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=plastoquinol-9}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ijbljlrewplepb-iqsnhbbhsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=751.23}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-12829
- common-name:
- plastoquinol-9
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(c)=cccc(=cccc(c)=cccc(c)=ccc1(=cc(=c(c(=c1o)c)c)o))c)c)c
- inchi-key:
- ijbljlrewplepb-iqsnhbbhsa-n
- molecular-weight:
- 751.23
