Difference between revisions of "Methylated-Ribosomal-Protein-L11s"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13403 == * common-name: ** l-alanyl-l-glutamine * smiles: ** cc([n+])c(=o)nc(c([o-])=o)ccc(=o)n * inchi-key: ** hjcmdxdypoufdy-whfbia...") |
(Created page with "Category:metabolite == Metabolite Methylated-Ribosomal-Protein-L11s == * common-name: ** a methylated ribosomal protein l11 == Reaction(s) known to consume the compound ==...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Methylated-Ribosomal-Protein-L11s == |
* common-name: | * common-name: | ||
| − | ** | + | ** a methylated ribosomal protein l11 |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN0-5419]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a methylated ribosomal protein l11}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite Methylated-Ribosomal-Protein-L11s
- common-name:
- a methylated ribosomal protein l11
