Difference between revisions of "CPD-16458"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-4-aminobutylidene-enzyme-lysine == * common-name: ** a [deoxyhypusine synthase]-n-(4-aminobutylidene)-lysine == Reaction(s) known to co...") |
(Created page with "Category:metabolite == Metabolite CPD-16458 == * common-name: ** 7,8-dihydrolumazine * smiles: ** c2(=o)(c1(=c(ncc=n1)nc(=o)n2)) * inchi-key: ** myjneehzesremo-uhfffaoysa-...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-16458 == |
* common-name: | * common-name: | ||
− | ** | + | ** 7,8-dihydrolumazine |
+ | * smiles: | ||
+ | ** c2(=o)(c1(=c(ncc=n1)nc(=o)n2)) | ||
+ | * inchi-key: | ||
+ | ** myjneehzesremo-uhfffaoysa-n | ||
+ | * molecular-weight: | ||
+ | ** 166.139 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-15261]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=7,8-dihydrolumazine}} |
+ | {{#set: inchi-key=inchikey=myjneehzesremo-uhfffaoysa-n}} | ||
+ | {{#set: molecular-weight=166.139}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-16458
- common-name:
- 7,8-dihydrolumazine
- smiles:
- c2(=o)(c1(=c(ncc=n1)nc(=o)n2))
- inchi-key:
- myjneehzesremo-uhfffaoysa-n
- molecular-weight:
- 166.139