Difference between revisions of "PROTOPORPHYRIN IX"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-20680 == * common-name: ** diadinoxanthin * smiles: ** cc(c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)=cc=cc=c(c)c=cc=c(c)c=cc23(c(c)(c)cc(o)...")
(Created page with "Category:metabolite == Metabolite PROTOPORPHYRIN_IX == * common-name: ** protoporphyrin ix * smiles: ** c=cc1(c(c)=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-20680 ==
+
== Metabolite PROTOPORPHYRIN_IX ==
 
* common-name:
 
* common-name:
** diadinoxanthin
+
** protoporphyrin ix
 
* smiles:
 
* smiles:
** cc(c=cc=c(c#cc1(=c(c)cc(o)cc(c)(c)1))c)=cc=cc=c(c)c=cc=c(c)c=cc23(c(c)(c)cc(o)cc(c)(o2)3)
+
** c=cc1(c(c)=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(c=c)=c(c)c(=cc=1n2)n=3))n4))=n5)))
 
* inchi-key:
 
* inchi-key:
** oghzcsinimwcsb-ghiqlmqgsa-n
+
** ksfovussgskxfi-ujjxfscmsa-l
 
* molecular-weight:
 
* molecular-weight:
** 582.865
+
** 560.651
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-19200]]
+
* [[PROTOHEMEFERROCHELAT-RXN]]
 +
* [[RXN1F-20]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-19202]]
+
* [[PPPGO]]
 +
* [[PROTOHEMEFERROCHELAT-RXN]]
 +
* [[PROTOPORGENOXI-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=diadinoxanthin}}
+
{{#set: common-name=protoporphyrin ix}}
{{#set: inchi-key=inchikey=oghzcsinimwcsb-ghiqlmqgsa-n}}
+
{{#set: inchi-key=inchikey=ksfovussgskxfi-ujjxfscmsa-l}}
{{#set: molecular-weight=582.865}}
+
{{#set: molecular-weight=560.651}}

Latest revision as of 11:12, 18 March 2021

Metabolite PROTOPORPHYRIN_IX

  • common-name:
    • protoporphyrin ix
  • smiles:
    • c=cc1(c(c)=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(c=c)=c(c)c(=cc=1n2)n=3))n4))=n5)))
  • inchi-key:
    • ksfovussgskxfi-ujjxfscmsa-l
  • molecular-weight:
    • 560.651

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality