Difference between revisions of "DIETHYLTHIOPHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 6Z8E10E14Z-5S12R-512-DIHYDROXYI == * common-name: ** leukotriene b4 * smiles: ** cccccc=ccc(o)c=cc=cc=cc(o)cccc(=o)[o-] * inchi-key: ** v...") |
(Created page with "Category:metabolite == Metabolite DIETHYLTHIOPHOSPHATE == * common-name: ** diethylthiophosphate * smiles: ** ccop(=s)([o-])occ * inchi-key: ** pkuwkaxtavnijr-uhfffaoysa-m...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DIETHYLTHIOPHOSPHATE == |
* common-name: | * common-name: | ||
− | ** | + | ** diethylthiophosphate |
* smiles: | * smiles: | ||
− | ** | + | ** ccop(=s)([o-])occ |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** pkuwkaxtavnijr-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 169.155 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[AMINOPARATHION-PHOSPHATASE-RXN]] |
+ | * [[ARYLDIALKYL-PHOSPHATASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=diethylthiophosphate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pkuwkaxtavnijr-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=169.155}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite DIETHYLTHIOPHOSPHATE
- common-name:
- diethylthiophosphate
- smiles:
- ccop(=s)([o-])occ
- inchi-key:
- pkuwkaxtavnijr-uhfffaoysa-m
- molecular-weight:
- 169.155