Difference between revisions of "CPD-4203"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18550 == * common-name: ** quinoxaline-2-carboxyl adenylate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)c4(c=...")
(Created page with "Category:metabolite == Metabolite CPD-4203 == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-diphosphate * smiles: ** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)(...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18550 ==
+
== Metabolite CPD-4203 ==
 
* common-name:
 
* common-name:
** quinoxaline-2-carboxyl adenylate
+
** n6-(δ2-isopentenyl)-adenosine 5'-diphosphate
 
* smiles:
 
* smiles:
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)c4(c=nc5(=cc=cc=c(n=4)5)))([o-])=o
+
** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])[o-])([o-])=o)o)o))c=nc=23)))c
 
* inchi-key:
 
* inchi-key:
** vmjweicpcdrxql-scfuhwhpsa-m
+
** vxmxkdahjurhen-sdbhatresa-k
 
* molecular-weight:
 
* molecular-weight:
** 502.359
+
** 492.298
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17155]]
+
* [[RXN-4311]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-4305]]
 +
* [[RXN-4311]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=quinoxaline-2-carboxyl adenylate}}
+
{{#set: common-name=n6-(δ2-isopentenyl)-adenosine 5'-diphosphate}}
{{#set: inchi-key=inchikey=vmjweicpcdrxql-scfuhwhpsa-m}}
+
{{#set: inchi-key=inchikey=vxmxkdahjurhen-sdbhatresa-k}}
{{#set: molecular-weight=502.359}}
+
{{#set: molecular-weight=492.298}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-4203

  • common-name:
    • n6-(δ2-isopentenyl)-adenosine 5'-diphosphate
  • smiles:
    • cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])[o-])([o-])=o)o)o))c=nc=23)))c
  • inchi-key:
    • vxmxkdahjurhen-sdbhatresa-k
  • molecular-weight:
    • 492.298

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality