Difference between revisions of "Plasmanylcholine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15301 == * common-name: ** caldariellaquinol * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(c(sc)=c(o)c1(=c(sc=c1)c(o)=2))...")
(Created page with "Category:metabolite == Metabolite Plasmanylcholine == * common-name: ** a plasmanylcholine == Reaction(s) known to consume the compound == == Reaction(s) known to produce...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15301 ==
+
== Metabolite Plasmanylcholine ==
 
* common-name:
 
* common-name:
** caldariellaquinol
+
** a plasmanylcholine
* smiles:
 
** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc2(c(sc)=c(o)c1(=c(sc=c1)c(o)=2))
 
* inchi-key:
 
** uvcqokdzgiahdg-uhfffaoysa-n
 
* molecular-weight:
 
** 633.085
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15378]]
+
* [[RXN-17733]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=caldariellaquinol}}
+
{{#set: common-name=a plasmanylcholine}}
{{#set: inchi-key=inchikey=uvcqokdzgiahdg-uhfffaoysa-n}}
 
{{#set: molecular-weight=633.085}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite Plasmanylcholine

  • common-name:
    • a plasmanylcholine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality