Difference between revisions of "CPD-12253"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1107 == * common-name: ** d-myo-inositol 1,3,4,5,6-pentakisphosphate * smiles: ** c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o...")
(Created page with "Category:metabolite == Metabolite CPD-12253 == * common-name: ** (r)-2-hydroxybutanoate * smiles: ** ccc(o)c(=o)[o-] * inchi-key: ** afendnxgafykqo-gsvougtgsa-m * molecula...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-1107 ==
+
== Metabolite CPD-12253 ==
 
* common-name:
 
* common-name:
** d-myo-inositol 1,3,4,5,6-pentakisphosphate
+
** (r)-2-hydroxybutanoate
 
* smiles:
 
* smiles:
** c1(o)(c(op([o-])([o-])=o)c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
+
** ccc(o)c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** ctpqaxvnygzuaj-kxxvrosksa-d
+
** afendnxgafykqo-gsvougtgsa-m
 
* molecular-weight:
 
* molecular-weight:
** 569.977
+
** 103.097
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10963]]
+
* [[RXN-13719]]
* [[RXN-13197]]
 
* [[RXN-7163]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.134-RXN]]
+
* [[RXN-13719]]
* [[2.7.1.140-RXN]]
 
* [[RXN-10963]]
 
* [[RXN-13197]]
 
* [[RXN-7162]]
 
* [[RXN-7184]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol 1,3,4,5,6-pentakisphosphate}}
+
{{#set: common-name=(r)-2-hydroxybutanoate}}
{{#set: inchi-key=inchikey=ctpqaxvnygzuaj-kxxvrosksa-d}}
+
{{#set: inchi-key=inchikey=afendnxgafykqo-gsvougtgsa-m}}
{{#set: molecular-weight=569.977}}
+
{{#set: molecular-weight=103.097}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-12253

  • common-name:
    • (r)-2-hydroxybutanoate
  • smiles:
    • ccc(o)c(=o)[o-]
  • inchi-key:
    • afendnxgafykqo-gsvougtgsa-m
  • molecular-weight:
    • 103.097

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality