Difference between revisions of "L-SELENOCYSTEINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13394 == * common-name: ** glycyl-l-glutamine * smiles: ** c([n+])c(=o)nc(c([o-])=o)ccc(=o)n * inchi-key: ** pnmuaggsdzxthx-bypyzucns...") |
(Created page with "Category:metabolite == Metabolite L-SELENOCYSTEINE == * common-name: ** l-selenocysteine * smiles: ** c([se])c([n+])c([o-])=o * inchi-key: ** zkzbpngneqajsx-reohclbhsa-n *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite L-SELENOCYSTEINE == |
* common-name: | * common-name: | ||
− | ** | + | ** l-selenocysteine |
* smiles: | * smiles: | ||
− | ** c([ | + | ** c([se])c([n+])c([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** zkzbpngneqajsx-reohclbhsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 168.054 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ACHMSSELCYSL]] |
+ | * [[ACHMSSELCYSLh]] | ||
+ | * [[RXN-12728]] | ||
+ | * [[SELENOCYSTEINE-LYASE-RXN]] | ||
+ | * [[SUCHMSSELCYSL]] | ||
+ | * [[SUCHMSSELCYSLh]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-12726]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=l-selenocysteine}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zkzbpngneqajsx-reohclbhsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=168.054}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite L-SELENOCYSTEINE
- common-name:
- l-selenocysteine
- smiles:
- c([se])c([n+])c([o-])=o
- inchi-key:
- zkzbpngneqajsx-reohclbhsa-n
- molecular-weight:
- 168.054