Difference between revisions of "CPD-563"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15687 == * common-name: ** 5-cis, 7-trans-3-oxo-tetradecadienoyl-coa * smiles: ** ccccccc=cc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c...")
(Created page with "Category:metabolite == Metabolite CPD-563 == * common-name: ** a 1-(1-alkenyl)-sn-glycero-3-phosphocholine == Reaction(s) known to consume the compound == * PLASMALOGEN-...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15687 ==
+
== Metabolite CPD-563 ==
 
* common-name:
 
* common-name:
** 5-cis, 7-trans-3-oxo-tetradecadienoyl-coa
+
** a 1-(1-alkenyl)-sn-glycero-3-phosphocholine
* smiles:
 
** ccccccc=cc=ccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** njxbfcfhvuiemz-qtjplklfsa-j
 
* molecular-weight:
 
** 983.813
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14799]]
+
* [[PLASMALOGEN-SYNTHASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[PLASMALOGEN-SYNTHASE-RXN]]
 +
* [[RXN-17736]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-cis, 7-trans-3-oxo-tetradecadienoyl-coa}}
+
{{#set: common-name=a 1-(1-alkenyl)-sn-glycero-3-phosphocholine}}
{{#set: inchi-key=inchikey=njxbfcfhvuiemz-qtjplklfsa-j}}
 
{{#set: molecular-weight=983.813}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-563

  • common-name:
    • a 1-(1-alkenyl)-sn-glycero-3-phosphocholine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality