Difference between revisions of "CPD-712"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GAMA-TOCOPHEROL == * common-name: ** γ-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=cc(o)=c(c)c(=c(o1)2)c)) * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite CPD-712 == * common-name: ** 6-deoxocathasterone * smiles: ** cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-712 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 6-deoxocathasterone |
* smiles: | * smiles: | ||
| − | ** cc(c) | + | ** cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34)))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** zhzkwzjlunxosn-yuzbouazsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 418.702 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-773]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=6-deoxocathasterone}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zhzkwzjlunxosn-yuzbouazsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=418.702}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-712
- common-name:
- 6-deoxocathasterone
- smiles:
- cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))
- inchi-key:
- zhzkwzjlunxosn-yuzbouazsa-n
- molecular-weight:
- 418.702
