Difference between revisions of "CPD-12860"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10664 == * common-name: ** 5-methylsalicylate * smiles: ** cc1(=cc(=c(c=c1)o)c([o-])=o) * inchi-key: ** dlgbegbhxsaqoc-uhfffaoysa-m *...") |
(Created page with "Category:metabolite == Metabolite CPD-12860 == * common-name: ** 4α-methyl-5α-cholesta-7,24-dien-3β-ol * inchi-key: ** mupkqzrbzsoulx-sponxpensa-n * molec...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-12860 == |
* common-name: | * common-name: | ||
− | ** 5- | + | ** 4α-methyl-5α-cholesta-7,24-dien-3β-ol |
− | |||
− | |||
* inchi-key: | * inchi-key: | ||
− | ** | + | ** mupkqzrbzsoulx-sponxpensa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 398.671 |
+ | * smiles: | ||
+ | ** cc(c)=ccc[c@@h](c)[c@@h]3(cc[c@@h]4(c1([c@@h]([c@]2(cc[c@h](o)[c@@h](c)[c@h](cc=1)2)(c))cc[c@](c)34))) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-21833]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=5- | + | {{#set: common-name=4α-methyl-5α-cholesta-7,24-dien-3β-ol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mupkqzrbzsoulx-sponxpensa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=398.671}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-12860
- common-name:
- 4α-methyl-5α-cholesta-7,24-dien-3β-ol
- inchi-key:
- mupkqzrbzsoulx-sponxpensa-n
- molecular-weight:
- 398.671
- smiles:
- cc(c)=ccc[c@@h](c)[c@@h]3(cc[c@@h]4(c1([c@@h]([c@]2(cc[c@h](o)[c@@h](c)[c@h](cc=1)2)(c))cc[c@](c)34)))