Difference between revisions of "CPD-15317"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11398 == * common-name: ** l-thyroxine phenolic β-d-glucuronide * smiles: ** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=c(i)c(...")
(Created page with "Category:metabolite == Metabolite CPD-15317 == * common-name: ** d-ribofuranose 5-phosphate == Reaction(s) known to consume the compound == * RXN0-5398 == Reaction(s)...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11398 ==
+
== Metabolite CPD-15317 ==
 
* common-name:
 
* common-name:
** l-thyroxine phenolic β-d-glucuronide
+
** d-ribofuranose 5-phosphate
* smiles:
 
** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=c(i)c(oc2(oc(c(=o)[o-])c(o)c(o)c(o)2))=c(i)c=3))
 
* inchi-key:
 
** rghrjbikiyuhev-sgpdefqssa-m
 
* molecular-weight:
 
** 951.992
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-5398]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10606]]
+
* [[RXN-4313]]
 +
* [[RXN0-1441]]
 +
* [[RXN0-5398]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-thyroxine phenolic β-d-glucuronide}}
+
{{#set: common-name=d-ribofuranose 5-phosphate}}
{{#set: inchi-key=inchikey=rghrjbikiyuhev-sgpdefqssa-m}}
 
{{#set: molecular-weight=951.992}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-15317

  • common-name:
    • d-ribofuranose 5-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality