Difference between revisions of "23S-rRNA-cytosine-1962"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UNDECAPRENYL-DIPHOSPHATE == * common-name: ** di-trans,octa-cis-undecaprenyl diphosphate * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=ccc...")
(Created page with "Category:metabolite == Metabolite 23S-rRNA-cytosine-1962 == * common-name: ** a cytosine1962 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11602 ==...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UNDECAPRENYL-DIPHOSPHATE ==
+
== Metabolite 23S-rRNA-cytosine-1962 ==
 
* common-name:
 
* common-name:
** di-trans,octa-cis-undecaprenyl diphosphate
+
** a cytosine1962 in 23s rrna
* smiles:
 
** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-])c)c)c
 
* inchi-key:
 
** ntxgvhccxvhycl-ntdveaecsa-k
 
* molecular-weight:
 
** 924.251
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11602]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8999]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=di-trans,octa-cis-undecaprenyl diphosphate}}
+
{{#set: common-name=a cytosine1962 in 23s rrna}}
{{#set: inchi-key=inchikey=ntxgvhccxvhycl-ntdveaecsa-k}}
 
{{#set: molecular-weight=924.251}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite 23S-rRNA-cytosine-1962

  • common-name:
    • a cytosine1962 in 23s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality