Difference between revisions of "GERANYLGERANYL-PP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9067 == * smiles: ** ccc5(c(c)c9(n6([mg]27(n1(c(c(c)c(ccc(=o)occ=c(c)cccc(c)cccc(c)cccc(c)c)c=1c4([c-](c(oc)=o)c(=o)c3(=c(c)c(n2c3=4)...") |
(Created page with "Category:metabolite == Metabolite GERANYLGERANYL-PP == * common-name: ** geranylgeranyl diphosphate * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite GERANYLGERANYL-PP == |
+ | * common-name: | ||
+ | ** geranylgeranyl diphosphate | ||
* smiles: | * smiles: | ||
− | ** | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-] |
− | * | + | * inchi-key: |
− | ** | + | ** oinneunvozhbox-qircyjposa-k |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 447.424 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[2.5.1.32-RXN]] |
+ | * [[2.5.1.41-RXN]] | ||
+ | * [[2.5.1.42-RXN]] | ||
+ | * [[RXN-10625]] | ||
+ | * [[RXN-11486]] | ||
+ | * [[RXN-11488]] | ||
+ | * [[RXN-13323]] | ||
+ | * [[RXN-14929]] | ||
+ | * [[RXN-17480]] | ||
+ | * [[RXN-3701]] | ||
+ | * [[RXN-7658]] | ||
+ | * [[RXN-7663]] | ||
+ | * [[RXN-7673]] | ||
+ | * [[RXN-8788]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[FARNESYLTRANSTRANSFERASE-RXN]] |
− | * [[RXN- | + | * [[GGPS]] |
+ | * [[RXN-3701]] | ||
+ | * [[RXN-7658]] | ||
+ | * [[RXN-7673]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=geranylgeranyl diphosphate}} |
− | {{#set: molecular-weight= | + | {{#set: inchi-key=inchikey=oinneunvozhbox-qircyjposa-k}} |
+ | {{#set: molecular-weight=447.424}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite GERANYLGERANYL-PP
- common-name:
- geranylgeranyl diphosphate
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
- inchi-key:
- oinneunvozhbox-qircyjposa-k
- molecular-weight:
- 447.424
Reaction(s) known to consume the compound
- 2.5.1.32-RXN
- 2.5.1.41-RXN
- 2.5.1.42-RXN
- RXN-10625
- RXN-11486
- RXN-11488
- RXN-13323
- RXN-14929
- RXN-17480
- RXN-3701
- RXN-7658
- RXN-7663
- RXN-7673
- RXN-8788