Difference between revisions of "CPD-11403"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P == * common-name: ** phosphoribulosylformimino-aicar-phosphate * smiles: ** c(op(=o)([o-])[o-])c(o)c(o...")
(Created page with "Category:metabolite == Metabolite CPD-11403 == * common-name: ** tetraiodothyroacetate * smiles: ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2)) * inchi-key: *...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHOSPHORIBULOSYL-FORMIMINO-AICAR-P ==
+
== Metabolite CPD-11403 ==
 
* common-name:
 
* common-name:
** phosphoribulosylformimino-aicar-phosphate
+
** tetraiodothyroacetate
 
* smiles:
 
* smiles:
** c(op(=o)([o-])[o-])c(o)c(o)c(=o)cn=cnc2(n(c1(c(o)c(c(cop(=o)([o-])[o-])o1)o))c=nc(c(=o)n)=2)
+
** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2))
 
* inchi-key:
 
* inchi-key:
** blkfnhochnclii-ghvqhmavsa-j
+
** ppjyssnksxavdb-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 573.303
+
** 746.825
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLUTAMIDOTRANS-RXN]]
+
* [[RXN-10616]]
* [[RXN-17900]]
+
* [[RXN-10617]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PRIBFAICARPISOM-RXN]]
 
* [[PRICI]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phosphoribulosylformimino-aicar-phosphate}}
+
{{#set: common-name=tetraiodothyroacetate}}
{{#set: inchi-key=inchikey=blkfnhochnclii-ghvqhmavsa-j}}
+
{{#set: inchi-key=inchikey=ppjyssnksxavdb-uhfffaoysa-m}}
{{#set: molecular-weight=573.303}}
+
{{#set: molecular-weight=746.825}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-11403

  • common-name:
    • tetraiodothyroacetate
  • smiles:
    • c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c(i)=c2))
  • inchi-key:
    • ppjyssnksxavdb-uhfffaoysa-m
  • molecular-weight:
    • 746.825

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality