Difference between revisions of "ALA-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14795 == * common-name: ** udp-n-acetyl-α-d-galactosamine * smiles: ** cc(nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-...")
(Created page with "Category:metabolite == Metabolite ALA-tRNAs == * common-name: ** a trnaala == Reaction(s) known to consume the compound == * ALANINE--TRNA-LIGASE-RXN == Reaction(s) kn...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14795 ==
+
== Metabolite ALA-tRNAs ==
 
* common-name:
 
* common-name:
** udp-n-acetyl-α-d-galactosamine
+
** a trnaala
* smiles:
 
** cc(nc3(c(op(op(occ1(c(c(c(o1)n2(c=cc(nc2=o)=o))o)o))([o-])=o)([o-])=o)oc(c(c3o)o)co))=o
 
* inchi-key:
 
** lftytuazoprmmi-nessujcysa-l
 
* molecular-weight:
 
** 605.342
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13760]]
+
* [[ALANINE--TRNA-LIGASE-RXN]]
* [[RXN-14841]]
 
* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13760]]
 
* [[RXN-14841]]
 
* [[UDP-N-ACETYLGLUCOSAMINE-4-EPIMERASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-n-acetyl-α-d-galactosamine}}
+
{{#set: common-name=a trnaala}}
{{#set: inchi-key=inchikey=lftytuazoprmmi-nessujcysa-l}}
 
{{#set: molecular-weight=605.342}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite ALA-tRNAs

  • common-name:
    • a trnaala

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality