Difference between revisions of "Lysidine-tRNA-Ile2"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11408 == * common-name: ** triiodothyronine sulfate * smiles: ** c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))...")
(Created page with "Category:metabolite == Metabolite Lysidine-tRNA-Ile2 == * common-name: ** a lysidine34 in trnaile2 == Reaction(s) known to consume the compound == == Reaction(s) known to...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11408 ==
+
== Metabolite Lysidine-tRNA-Ile2 ==
 
* common-name:
 
* common-name:
** triiodothyronine sulfate
+
** a lysidine34 in trnaile2
* smiles:
 
** c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))=2)i)
 
* inchi-key:
 
** xbqyqxvjbndcgy-lbprgkrzsa-m
 
* molecular-weight:
 
** 730.028
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10615]]
+
* [[RXN-1961]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=triiodothyronine sulfate}}
+
{{#set: common-name=a lysidine34 in trnaile2}}
{{#set: inchi-key=inchikey=xbqyqxvjbndcgy-lbprgkrzsa-m}}
 
{{#set: molecular-weight=730.028}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite Lysidine-tRNA-Ile2

  • common-name:
    • a lysidine34 in trnaile2

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality