Difference between revisions of "CPD-22765"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-674 == * common-name: ** trans-cinnamate * smiles: ** c(=o)([o-])c=cc1(=cc=cc=c1) * inchi-key: ** wbywaxjhaxsjni-votsokgwsa-m * molec...") |
(Created page with "Category:metabolite == Metabolite CPD-22765 == == Reaction(s) known to consume the compound == * RXN21166 == Reaction(s) known to produce the compound == * [[RXN21165]...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-22765 == |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN21166]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN21165]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
− |