Difference between revisions of "TRNA-uridine65"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-663 == * common-name: ** udp-4-dehydro-6-deoxy-α-d-glucose * smiles: ** cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=...")
(Created page with "Category:metabolite == Metabolite tRNA-uridine65 == * common-name: ** a uridine65 in trna == Reaction(s) known to consume the compound == * RXN-11840 == Reaction(s) kn...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-663 ==
+
== Metabolite tRNA-uridine65 ==
 
* common-name:
 
* common-name:
** udp-4-dehydro-6-deoxy-α-d-glucose
+
** a uridine65 in trna
* smiles:
 
** cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)c(o)c(o)c(=o)3)
 
* inchi-key:
 
** ddwgqqadoimfoi-jphisprksa-l
 
* molecular-weight:
 
** 546.274
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-18332]]
+
* [[RXN-11840]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18332]]
 
* [[UDP-GLUCOSE-46-DEHYDRATASE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-4-dehydro-6-deoxy-α-d-glucose}}
+
{{#set: common-name=a uridine65 in trna}}
{{#set: inchi-key=inchikey=ddwgqqadoimfoi-jphisprksa-l}}
 
{{#set: molecular-weight=546.274}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite tRNA-uridine65

  • common-name:
    • a uridine65 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality