Difference between revisions of "CPD-16819"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Proteins-L-Threonines == * common-name: ** a [protein]-l-threonine == Reaction(s) known to consume the compound == * RXN-11890 * RX...")
(Created page with "Category:metabolite == Metabolite CPD-16819 == * common-name: ** 4-methylphenyl sulfate * smiles: ** cc1(c=cc(=cc=1)os(=o)(=o)[o-]) * inchi-key: ** wgnakzgusrvwrh-uhfffaoy...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Proteins-L-Threonines ==
+
== Metabolite CPD-16819 ==
 
* common-name:
 
* common-name:
** a [protein]-l-threonine
+
** 4-methylphenyl sulfate
 +
* smiles:
 +
** cc1(c=cc(=cc=1)os(=o)(=o)[o-])
 +
* inchi-key:
 +
** wgnakzgusrvwrh-uhfffaoysa-m
 +
* molecular-weight:
 +
** 187.19
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11890]]
+
* [[RXN-15588]]
* [[RXN-14906]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11890]]
+
* [[RXN-15588]]
* [[RXN-14906]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [protein]-l-threonine}}
+
{{#set: common-name=4-methylphenyl sulfate}}
 +
{{#set: inchi-key=inchikey=wgnakzgusrvwrh-uhfffaoysa-m}}
 +
{{#set: molecular-weight=187.19}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-16819

  • common-name:
    • 4-methylphenyl sulfate
  • smiles:
    • cc1(c=cc(=cc=1)os(=o)(=o)[o-])
  • inchi-key:
    • wgnakzgusrvwrh-uhfffaoysa-m
  • molecular-weight:
    • 187.19

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality