Difference between revisions of "CPD-342"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite GAMMA-LINOLENOYL-COA == * common-name: ** γ-linolenoyl-coa * smiles: ** cccccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o...")
(Created page with "Category:metabolite == Metabolite CPD-342 == * common-name: ** 5α-androstane-3,17-dione * smiles: ** cc12(ccc(c[ch]1cc[ch]4([ch]2ccc3([ch](ccc(=o)3)4)c))=o) * inchi-...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite GAMMA-LINOLENOYL-COA ==
+
== Metabolite CPD-342 ==
 
* common-name:
 
* common-name:
** γ-linolenoyl-coa
+
** 5α-androstane-3,17-dione
 
* smiles:
 
* smiles:
** cccccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc12(ccc(c[ch]1cc[ch]4([ch]2ccc3([ch](ccc(=o)3)4)c))=o)
 
* inchi-key:
 
* inchi-key:
** xzqyptbyqyzgru-fhdveodpsa-j
+
** rajwobjttgjroa-wznaksscsa-n
 
* molecular-weight:
 
* molecular-weight:
** 1023.921
+
** 288.429
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12777]]
+
* [[RXN-12124]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.14.19.3-RXN]]
 
* [[RXN-16043]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=γ-linolenoyl-coa}}
+
{{#set: common-name=5α-androstane-3,17-dione}}
{{#set: inchi-key=inchikey=xzqyptbyqyzgru-fhdveodpsa-j}}
+
{{#set: inchi-key=inchikey=rajwobjttgjroa-wznaksscsa-n}}
{{#set: molecular-weight=1023.921}}
+
{{#set: molecular-weight=288.429}}

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-342

  • common-name:
    • 5α-androstane-3,17-dione
  • smiles:
    • cc12(ccc(c[ch]1cc[ch]4([ch]2ccc3([ch](ccc(=o)3)4)c))=o)
  • inchi-key:
    • rajwobjttgjroa-wznaksscsa-n
  • molecular-weight:
    • 288.429

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality