Difference between revisions of "3-Phosphopolynucleotides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19169 == * common-name: ** 3-oxo-(9z)-octadecenoyl-coa * smiles: ** ccccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op...")
(Created page with "Category:metabolite == Metabolite 3-Phosphopolynucleotides == * common-name: ** a 3'-phosphopolynucleotide == Reaction(s) known to consume the compound == * POLYNUCLEOTI...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19169 ==
+
== Metabolite 3-Phosphopolynucleotides ==
 
* common-name:
 
* common-name:
** 3-oxo-(9z)-octadecenoyl-coa
+
** a 3'-phosphopolynucleotide
* smiles:
 
** ccccccccc=ccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** aveyykdekgjvbu-bpmmelmssa-j
 
* molecular-weight:
 
** 1041.936
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17778]]
+
* [[POLYNUCLEOTIDE-3-PHOSPHATASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17777]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(9z)-octadecenoyl-coa}}
+
{{#set: common-name=a 3'-phosphopolynucleotide}}
{{#set: inchi-key=inchikey=aveyykdekgjvbu-bpmmelmssa-j}}
 
{{#set: molecular-weight=1041.936}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite 3-Phosphopolynucleotides

  • common-name:
    • a 3'-phosphopolynucleotide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality