Difference between revisions of "PWY-7939"

Revision as of 09:22, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8268 CPD-8268] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PUTRESCINE PUTRESCINE] ==
 * common-name:
-** dioleoyl phosphatidate
+** putrescine
 * smiles:
-** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)[o-])=o
+** c([n+])ccc[n+]
 * inchi-key:
-** mhuwzntuiifhas-dssvuwshsa-l
+** kidhwzjucrjvml-uhfffaoysa-p
 * molecular-weight:
-** 698.959
+** 90.168
 == Reaction(s) known to consume the compound ==
-* [[RXN-15068]]
+* [[ABC-25-RXN]]
+* [[APAPT]]
+* [[SPERMIDINESYN-RXN]]
+* [[TRANS-RXN-69]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-15043]]
+* [[ABC-25-RXN]]
+* [[AGMATIN-RXN]]
+* [[N-CARBAMOYLPUTRESCINE-AMIDASE-RXN]]
+* [[ORDC]]
+* [[ORNDECARBOX-RXN]]
+* [[SPERMIDINESYN-RXN]]
+* [[TRANS-RXN-69]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=dioleoyl phosphatidate}}
+{{#set: common-name=putrescine}}
-{{#set: inchi-key=inchikey=mhuwzntuiifhas-dssvuwshsa-l}}
+{{#set: inchi-key=inchikey=kidhwzjucrjvml-uhfffaoysa-p}}
-{{#set: molecular-weight=698.959}}
+{{#set: molecular-weight=90.168}}