Difference between revisions of "PWY-6969"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12016 CPD-12016] == * common-name: ** n-acetyl-serotonin glucuronide * smiles: ** cc(=o)ncc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ribonucleosides Ribonucleosides] == * common-name: ** a ribonucleoside == Reaction(s) known to...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12016 CPD-12016] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Ribonucleosides Ribonucleosides] ==
 
* common-name:
 
* common-name:
** n-acetyl-serotonin glucuronide
+
** a ribonucleoside
* smiles:
 
** cc(=o)nccc2(=cnc3(=cc=c(oc1(oc(c([o-])=o)c(o)c(o)c(o)1))c=c23))
 
* inchi-key:
 
** drkqfnyksnwotc-rngzqalnsa-m
 
* molecular-weight:
 
** 393.372
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11060]]
+
* [[5-NUCLEOTID-RXN]]
 +
* [[RXN-17948]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-serotonin glucuronide}}
+
{{#set: common-name=a ribonucleoside}}
{{#set: inchi-key=inchikey=drkqfnyksnwotc-rngzqalnsa-m}}
 
{{#set: molecular-weight=393.372}}
 

Revision as of 09:22, 27 August 2019

Metabolite Ribonucleosides

  • common-name:
    • a ribonucleoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality