Difference between revisions of "PWY-1722"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOLICHOLP DOLICHOLP] == * common-name: ** a dolichyl phosphate == Reaction(s) known to consume...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12826 CPD-12826] == * common-name: ** folate * smiles: ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12826 CPD-12826] == |
* common-name: | * common-name: | ||
| − | ** | + | ** folate |
| + | * smiles: | ||
| + | ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c2(c=nc3(n=c(n)nc(=o)c(n=2)=3)) | ||
| + | * inchi-key: | ||
| + | ** ovbpiulpvideao-lbprgkrzsa-l | ||
| + | * molecular-weight: | ||
| + | ** 439.387 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DHFOR]] |
| − | * [[ | + | * [[FOLR2]] |
| − | * [[ | + | * [[THFOR1]] |
| − | * [[ | + | * [[THFOR2]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=folate}} |
| + | {{#set: inchi-key=inchikey=ovbpiulpvideao-lbprgkrzsa-l}} | ||
| + | {{#set: molecular-weight=439.387}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-12826
- common-name:
- folate
- smiles:
- c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c2(c=nc3(n=c(n)nc(=o)c(n=2)=3))
- inchi-key:
- ovbpiulpvideao-lbprgkrzsa-l
- molecular-weight:
- 439.387
