Difference between revisions of "PWY66-387"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14053 CPD-14053] == * common-name: ** (6r)-l-erythro-5,6,7,8-tetrahydrobiopterin * smiles:...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTEATE L-CYSTEATE] == * common-name: ** l-cysteate * smiles: ** c(c([n+])c(=o)[o-])s(=o)(=o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTEATE L-CYSTEATE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-cysteate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c([n+])c(=o)[o-])s(=o)(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xvoyscvbglvsol-reohclbhsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 168.144 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-11737]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-11737]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-cysteate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xvoyscvbglvsol-reohclbhsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=168.144}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite L-CYSTEATE
- common-name:
- l-cysteate
- smiles:
- c(c([n+])c(=o)[o-])s(=o)(=o)[o-]
- inchi-key:
- xvoyscvbglvsol-reohclbhsa-m
- molecular-weight:
- 168.144
