Difference between revisions of "PWY-702"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11400 CPD-11400] == * common-name: ** 3,5,3'-triiodo-l-thyronine phenolic β-d-glucuron...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Histone-N-o-methyl-arginines Histone-N-o-methyl-arginines] == * common-name: ** [histone]-n&ome...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11400 CPD-11400] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Histone-N-o-methyl-arginines Histone-N-o-methyl-arginines] ==
 
* common-name:
 
* common-name:
** 3,5,3'-triiodo-l-thyronine phenolic β-d-glucuronide
+
** [histone]-nω-methyl-arginine
* smiles:
 
** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=cc(oc2(oc(c(=o)[o-])c(o)c(o)c(o)2))=c(i)c=3))
 
* inchi-key:
 
** yyfgggcinngole-zdxogfqlsa-m
 
* molecular-weight:
 
** 826.095
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10607]]
+
* [[2.1.1.125-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,5,3'-triiodo-l-thyronine phenolic β-d-glucuronide}}
+
{{#set: common-name=[histone]-nω-methyl-arginine}}
{{#set: inchi-key=inchikey=yyfgggcinngole-zdxogfqlsa-m}}
 
{{#set: molecular-weight=826.095}}
 

Revision as of 09:22, 27 August 2019

Metabolite Histone-N-o-methyl-arginines

  • common-name:
    • [histone]-nω-methyl-arginine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "histone]-nω-methyl-arginine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.