Difference between revisions of "PWY66-221"

Revision as of 09:22, 27 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11401 CPD-11401] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DOPAMINE DOPAMINE] ==
 * common-name:
-** l-thyroxine acyl &beta;-d-glucuronide
+** dopamine
 * smiles:
-** c([o-])(=o)c1(oc(c(o)c(o)c(o)1)oc(=o)c(n)cc2(=cc(i)=c(c(i)=c2)oc3(=cc(i)=c(o)c(i)=c3)))
+** c(cc1(c=c(c(=cc=1)o)o))[n+]
 * inchi-key:
-** hmtfxpjobpioin-dkbymcrtsa-m
+** vyfyytllbukuhu-uhfffaoysa-o
 * molecular-weight:
-** 951.992
+** 154.188
 == Reaction(s) known to consume the compound ==
+* [[DOPAMINE-BETA-MONOOXYGENASE-RXN]]
+* [[RXN6666-4]]
+* [[RXN6666-9]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-10608]]
+* [[RXN66-221]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=l-thyroxine acyl &beta;-d-glucuronide}}
+{{#set: common-name=dopamine}}
-{{#set: inchi-key=inchikey=hmtfxpjobpioin-dkbymcrtsa-m}}
+{{#set: inchi-key=inchikey=vyfyytllbukuhu-uhfffaoysa-o}}
-{{#set: molecular-weight=951.992}}
+{{#set: molecular-weight=154.188}}