Difference between revisions of "PWY-6415"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-506 CPD-506] == * common-name: ** d-myo-inositol (1,3,4,5)-tetrakisphosphate * smiles: ** c...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] == * common-name: ** 4-coumaryl alcohol * smiles: ** c(=cc1(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-506 CPD-506] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COUMARYL-ALCOHOL COUMARYL-ALCOHOL] ==
 
* common-name:
 
* common-name:
** d-myo-inositol (1,3,4,5)-tetrakisphosphate
+
** 4-coumaryl alcohol
 
* smiles:
 
* smiles:
** c1(o)(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
+
** c(=cc1(=cc=c(o)c=c1))co
 
* inchi-key:
 
* inchi-key:
** cipfcgzlfxvxbg-cnwjwelysa-f
+
** ptnlhdgqwugons-owojbtedsa-n
 
* molecular-weight:
 
* molecular-weight:
** 492.013
+
** 150.177
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7184]]
 
* [[RXN-8730]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.127-RXN]]
+
* [[RXN-1102]]
* [[2.7.1.139-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol (1,3,4,5)-tetrakisphosphate}}
+
{{#set: common-name=4-coumaryl alcohol}}
{{#set: inchi-key=inchikey=cipfcgzlfxvxbg-cnwjwelysa-f}}
+
{{#set: inchi-key=inchikey=ptnlhdgqwugons-owojbtedsa-n}}
{{#set: molecular-weight=492.013}}
+
{{#set: molecular-weight=150.177}}

Revision as of 09:22, 27 August 2019

Metabolite COUMARYL-ALCOHOL

  • common-name:
    • 4-coumaryl alcohol
  • smiles:
    • c(=cc1(=cc=c(o)c=c1))co
  • inchi-key:
    • ptnlhdgqwugons-owojbtedsa-n
  • molecular-weight:
    • 150.177

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality