Difference between revisions of "PWY-5934"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11690 CPD-11690] == * common-name: ** 1-oleoyl-sn-glycerol * smiles: ** ccccccccc=ccccccccc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRAZINAMIDE PYRAZINAMIDE] == * common-name: ** pyrazinamide * smiles: ** c1(n=cc=nc=1c(=o)n) *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11690 CPD-11690] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRAZINAMIDE PYRAZINAMIDE] ==
 
* common-name:
 
* common-name:
** 1-oleoyl-sn-glycerol
+
** pyrazinamide
 
* smiles:
 
* smiles:
** ccccccccc=ccccccccc(=o)occ(co)o
+
** c1(n=cc=nc=1c(=o)n)
 
* inchi-key:
 
* inchi-key:
** rzrnayuhwvfmip-qjrazlaksa-n
+
** ipehbumcgvemrf-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 356.545
+
** 123.114
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15089]]
+
* [[PYRAZIN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-oleoyl-sn-glycerol}}
+
{{#set: common-name=pyrazinamide}}
{{#set: inchi-key=inchikey=rzrnayuhwvfmip-qjrazlaksa-n}}
+
{{#set: inchi-key=inchikey=ipehbumcgvemrf-uhfffaoysa-n}}
{{#set: molecular-weight=356.545}}
+
{{#set: molecular-weight=123.114}}

Revision as of 09:22, 27 August 2019

Metabolite PYRAZINAMIDE

  • common-name:
    • pyrazinamide
  • smiles:
    • c1(n=cc=nc=1c(=o)n)
  • inchi-key:
    • ipehbumcgvemrf-uhfffaoysa-n
  • molecular-weight:
    • 123.114

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality