Difference between revisions of "PWY-5"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-10-METHENYL-THF 5-10-METHENYL-THF] == * common-name: ** 5,10-methenyltetrahydrofolate mono-l-...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1099 CPD-1099] == * common-name: ** raffinose * smiles: ** c(oc1(c(c(c(c(co)o1)o)o)o))c2(c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-10-METHENYL-THF 5-10-METHENYL-THF] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1099 CPD-1099] ==
 
* common-name:
 
* common-name:
** 5,10-methenyltetrahydrofolate mono-l-glutamate
+
** raffinose
 
* smiles:
 
* smiles:
** c4(nc1(n=c(n)nc(=o)c=1[n+]3(=cn(c2(=cc=c(c=c2)c(=o)nc(ccc([o-])=o)c([o-])=o))c[ch]34)))
+
** c(oc1(c(c(c(c(co)o1)o)o)o))c2(c(c(c(c(o2)oc3(co)(c(c(c(co)o3)o)o))o)o)o)
 
* inchi-key:
 
* inchi-key:
** meanfmoqmxymct-olzocxbdsa-m
+
** mupfekgtmrgplj-zqskzdjdsa-n
 
* molecular-weight:
 
* molecular-weight:
** 454.421
+
** 504.441
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[METHFth]]
+
* [[2.4.1.67-RXN]]
* [[MTHFD2]]
+
* [[RXN-11502]]
* [[MTHFD2i]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[FGFTh]]
+
* [[2.4.1.67-RXN]]
* [[METHFth]]
+
* [[2.4.1.82-RXN]]
* [[MTHFCx]]
+
* [[RXN-11501]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5,10-methenyltetrahydrofolate mono-l-glutamate}}
+
{{#set: common-name=raffinose}}
{{#set: inchi-key=inchikey=meanfmoqmxymct-olzocxbdsa-m}}
+
{{#set: inchi-key=inchikey=mupfekgtmrgplj-zqskzdjdsa-n}}
{{#set: molecular-weight=454.421}}
+
{{#set: molecular-weight=504.441}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-1099

  • common-name:
    • raffinose
  • smiles:
    • c(oc1(c(c(c(c(co)o1)o)o)o))c2(c(c(c(c(o2)oc3(co)(c(c(c(co)o3)o)o))o)o)o)
  • inchi-key:
    • mupfekgtmrgplj-zqskzdjdsa-n
  • molecular-weight:
    • 504.441

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality