Difference between revisions of "PWY-7790"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11674 CPD-11674] == * common-name: ** 5-hydroxytryptophol sulfate * smiles: ** c(o)cc1(=cnc...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-671 CPD-671] == * common-name: ** a 5-formiminotetrahydrofolate == Reaction(s) known to con...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11674 CPD-11674] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-671 CPD-671] ==
 
* common-name:
 
* common-name:
** 5-hydroxytryptophol sulfate
+
** a 5-formiminotetrahydrofolate
* smiles:
 
** c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2))
 
* inchi-key:
 
** focuajyuoxsnds-uhfffaoysa-m
 
* molecular-weight:
 
** 256.253
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10782]]
+
* [[GLUTAMATE-FORMIMINOTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-hydroxytryptophol sulfate}}
+
{{#set: common-name=a 5-formiminotetrahydrofolate}}
{{#set: inchi-key=inchikey=focuajyuoxsnds-uhfffaoysa-m}}
 
{{#set: molecular-weight=256.253}}
 

Revision as of 14:19, 26 August 2019

Metabolite CPD-671

  • common-name:
    • a 5-formiminotetrahydrofolate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality