Difference between revisions of "PWY-6759"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-Gal-NAc--Glycoproteins D-Gal-NAc--Glycoproteins] == * common-name: ** an n-acetyl-α-d-g...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] == * common-name: ** d-galactosylononitol * smiles: ** coc1(c(c(c(c(c1o)o)o)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8058 CPD-8058] == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-galactosylononitol |
| + | * smiles: | ||
| + | ** coc1(c(c(c(c(c1o)o)o)o)oc2(c(c(c(c(o2)co)o)o)o)) | ||
| + | * inchi-key: | ||
| + | ** rsyncmydvzfzbp-nrorzaabsa-n | ||
| + | * molecular-weight: | ||
| + | ** 356.326 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-8281]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-galactosylononitol}} |
| + | {{#set: inchi-key=inchikey=rsyncmydvzfzbp-nrorzaabsa-n}} | ||
| + | {{#set: molecular-weight=356.326}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-8058
- common-name:
- d-galactosylononitol
- smiles:
- coc1(c(c(c(c(c1o)o)o)o)oc2(c(c(c(c(o2)co)o)o)o))
- inchi-key:
- rsyncmydvzfzbp-nrorzaabsa-n
- molecular-weight:
- 356.326
