Difference between revisions of "PWY-5739"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-arabinopyranose L-arabinopyranose] == == Reaction(s) known to consume the compound == * RXN...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-476 CPD-476] == * common-name: ** 4-(2-aminophenyl)-2,4-dioxobutanoate * smiles: ** c(c(cc(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-476 CPD-476] == |
| + | * common-name: | ||
| + | ** 4-(2-aminophenyl)-2,4-dioxobutanoate | ||
| + | * smiles: | ||
| + | ** c(c(cc(c1(c(=cc=cc=1)n))=o)=o)([o-])=o | ||
| + | * inchi-key: | ||
| + | ** caovwyzqmpnafj-uhfffaoysa-m | ||
| + | * molecular-weight: | ||
| + | ** 206.177 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[2.6.1.7-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[2.6.1.7-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=4-(2-aminophenyl)-2,4-dioxobutanoate}} | ||
| + | {{#set: inchi-key=inchikey=caovwyzqmpnafj-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=206.177}} | ||
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-476
- common-name:
- 4-(2-aminophenyl)-2,4-dioxobutanoate
- smiles:
- c(c(cc(c1(c(=cc=cc=1)n))=o)=o)([o-])=o
- inchi-key:
- caovwyzqmpnafj-uhfffaoysa-m
- molecular-weight:
- 206.177
