Difference between revisions of "TRPSYN-PWY"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] == * common-name: ** urate * smiles: ** c12(nc(=o)nc=1c(=o)nc(=o)n2) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CRPB-all-trans-Retinol CRPB-all-trans-Retinol] == * common-name: ** an all-trans retinol-[cellu...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CRPB-all-trans-Retinol CRPB-all-trans-Retinol] == |
* common-name: | * common-name: | ||
| − | ** | + | ** an all-trans retinol-[cellular-retinol-binding-protein] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12581]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an all-trans retinol-[cellular-retinol-binding-protein]}} |
| − | |||
| − | |||
Revision as of 09:22, 27 August 2019
Contents
Metabolite CRPB-all-trans-Retinol
- common-name:
- an all-trans retinol-[cellular-retinol-binding-protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "an all-trans retinol-[cellular-retinol-binding-protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
