Difference between revisions of "PWY-5137"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15651 CPD-15651] == * common-name: ** 6-trans-tridecenoyl-coa * smiles: ** ccccccc=cccccc(=...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-ALA-D-ALA D-ALA-D-ALA] == * common-name: ** d-alanyl-d-alanine * smiles: ** cc([n+])c(=o)nc(c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-ALA-D-ALA D-ALA-D-ALA] == |
* common-name: | * common-name: | ||
| − | ** | + | ** d-alanyl-d-alanine |
* smiles: | * smiles: | ||
| − | ** | + | ** cc([n+])c(=o)nc(c)c([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** defjqiddeaulhb-qwwzwvqmsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 160.172 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[DALADALALIG-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-alanyl-d-alanine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=defjqiddeaulhb-qwwzwvqmsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=160.172}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite D-ALA-D-ALA
- common-name:
- d-alanyl-d-alanine
- smiles:
- cc([n+])c(=o)nc(c)c([o-])=o
- inchi-key:
- defjqiddeaulhb-qwwzwvqmsa-n
- molecular-weight:
- 160.172
